C16H26NO3+ — CID 118135437
ethyl-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl]-dimethylazanium (PubChem CID 118135437) has the molecular formula C16H26NO3+ and a molecular weight of 280.39 g/mol. Its IUPAC name is ethyl-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl]-dimethylazanium.
| Compound Name | ethyl-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 118135437 |
| Molecular Formula | C16H26NO3+ |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | ethyl-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl]-dimethylazanium |
| SMILES | CC[N+](C)(C)CCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C16H26NO3/c1-6-17(4,5)11-12-20-14-9-7-13(8-10-14)15(18)16(2,3)19/h7-10,19H,6,11-12H2,1-5H3/q+1 |
| InChIKey | XAAHGNNZMGRJEO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|