C21H36O6 — CID 144680496
ethane;2-hydroxy-2-methyl-1-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]propan-1-one (PubChem CID 144680496) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is ethane;2-hydroxy-2-methyl-1-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]propan-1-one.
| Compound Name | ethane;2-hydroxy-2-methyl-1-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 144680496 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | ethane;2-hydroxy-2-methyl-1-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]propan-1-one |
| SMILES | CC.CCCOCCOCCOCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C19H30O6.C2H6/c1-4-9-22-10-11-23-12-13-24-14-15-25-17-7-5-16(6-8-17)18(20)19(2,3)21;1-2/h5-8,21H,4,9-15H2,1-3H3;1-2H3 |
| InChIKey | JCNMZQWIULSPMV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|