C17H24O6 — CID 151465505
ethyl 2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]propanoate (PubChem CID 151465505) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is ethyl 2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]propanoate.
| Compound Name | ethyl 2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 151465505 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl 2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]propanoate |
| SMILES | CCOC(=O)C(C)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C17H24O6/c1-5-21-16(19)12(2)22-10-11-23-14-8-6-13(7-9-14)15(18)17(3,4)20/h6-9,12,20H,5,10-11H2,1-4H3 |
| InChIKey | PJIXFQHNCNEZTG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|