C45H48O15 — CID 135308581
tris[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] benzene-1,3,5-tricarboxylate (PubChem CID 135308581) has the molecular formula C45H48O15 and a molecular weight of 828.86 g/mol. Its IUPAC name is tris[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] benzene-1,3,5-tricarboxylate.
| Compound Name | tris[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 135308581 |
| Molecular Formula | C45H48O15 |
| Molecular Weight | 828.86 g/mol |
| Exact Mass | 828.30 |
| IUPAC Name | tris[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] benzene-1,3,5-tricarboxylate |
| SMILES | CC(C)(O)C(=O)c1ccc(OCCOC(=O)c2cc(C(=O)OCCOc3ccc(C(=O)C(C)(C)O)cc3)cc(C(=O)OCCOc3ccc(C(=O)C(C)(C)O)cc3)c2)cc1 |
| InChI | InChI=1S/C45H48O15/c1-43(2,52)37(46)28-7-13-34(14-8-28)55-19-22-58-40(49)31-25-32(41(50)59-23-20-56-35-15-9-29(10-16-35)38(47)44(3,4)53)27-33(26-31)42(51)60-24-21-57-36-17-11-30(12-18-36)39(48)45(5,6)54/h7-18,25-27,52-54H,19-24H2,1-6H3 |
| InChIKey | KKEIXTBPSTVWQE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.86 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|