C13H18O4 — CID 20659085
2-hydroxy-1-[4-(2-methoxyethoxy)phenyl]-2-methylpropan-1-one (PubChem CID 20659085) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(2-methoxyethoxy)phenyl]-2-methylpropan-1-one.
| Compound Name | 2-hydroxy-1-[4-(2-methoxyethoxy)phenyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 20659085 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-hydroxy-1-[4-(2-methoxyethoxy)phenyl]-2-methylpropan-1-one |
| SMILES | COCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C13H18O4/c1-13(2,15)12(14)10-4-6-11(7-5-10)17-9-8-16-3/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | NXCPAXGIUPLERB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|