C12H18O4 — CID 162256777
2-hydroxy-1-[4-(hydroxymethoxy)phenyl]-2-methylpropan-1-one;methane (PubChem CID 162256777) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(hydroxymethoxy)phenyl]-2-methylpropan-1-one;methane.
| Compound Name | 2-hydroxy-1-[4-(hydroxymethoxy)phenyl]-2-methylpropan-1-one;methane |
|---|---|
| PubChem CID | 162256777 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-hydroxy-1-[4-(hydroxymethoxy)phenyl]-2-methylpropan-1-one;methane |
| SMILES | C.CC(C)(O)C(=O)c1ccc(OCO)cc1 |
| InChI | InChI=1S/C11H14O4.CH4/c1-11(2,14)10(13)8-3-5-9(6-4-8)15-7-12;/h3-6,12,14H,7H2,1-2H3;1H4 |
| InChIKey | ZYRVBJDMCVHIJN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|