C13H21NO6 — CID 88854736
2-(3-prop-2-enoyloxypropoxycarbonylamino)ethyl butanoate (PubChem CID 88854736) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-(3-prop-2-enoyloxypropoxycarbonylamino)ethyl butanoate.
| Compound Name | 2-(3-prop-2-enoyloxypropoxycarbonylamino)ethyl butanoate |
|---|---|
| PubChem CID | 88854736 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-(3-prop-2-enoyloxypropoxycarbonylamino)ethyl butanoate |
| SMILES | C=CC(=O)OCCCOC(=O)NCCOC(=O)CCC |
| InChI | InChI=1S/C13H21NO6/c1-3-6-12(16)19-10-7-14-13(17)20-9-5-8-18-11(15)4-2/h4H,2-3,5-10H2,1H3,(H,14,17) |
| InChIKey | MQRVVPKBWQIBLY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|