C12H19NO6 — CID 140648691
2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylpropanoate (PubChem CID 140648691) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylpropanoate.
| Compound Name | 2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 140648691 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylpropanoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOC(=O)C(C)C |
| InChI | InChI=1S/C12H19NO6/c1-4-10(14)17-6-5-13-12(16)19-8-7-18-11(15)9(2)3/h4,9H,1,5-8H2,2-3H3,(H,13,16) |
| InChIKey | XRIXBXZOOKETCI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|