C13H23NO5 — CID 58252677
2-[2-(2-methylbutoxy)ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 58252677) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[2-(2-methylbutoxy)ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2-methylbutoxy)ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58252677 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[2-(2-methylbutoxy)ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOCC(C)CC |
| InChI | InChI=1S/C13H23NO5/c1-4-11(3)10-17-8-9-19-13(16)14-6-7-18-12(15)5-2/h5,11H,2,4,6-10H2,1,3H3,(H,14,16) |
| InChIKey | SHAWZCOTPMEPMD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|