C10H17NO5 — CID 170150798
2-(1-methoxypropan-2-yloxycarbonylamino)ethyl prop-2-enoate (PubChem CID 170150798) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(1-methoxypropan-2-yloxycarbonylamino)ethyl prop-2-enoate.
| Compound Name | 2-(1-methoxypropan-2-yloxycarbonylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 170150798 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-(1-methoxypropan-2-yloxycarbonylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OC(C)COC |
| InChI | InChI=1S/C10H17NO5/c1-4-9(12)15-6-5-11-10(13)16-8(2)7-14-3/h4,8H,1,5-7H2,2-3H3,(H,11,13) |
| InChIKey | JGWTZCJGAQKQQM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|