C17H26N2O8 — CID 58975887
2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 58975887) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58975887 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(C)OC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C17H26N2O8/c1-11(2)14(20)24-8-6-18-16(22)26-10-13(5)27-17(23)19-7-9-25-15(21)12(3)4/h13H,1,3,6-10H2,2,4-5H3,(H,18,22)(H,19,23) |
| InChIKey | VCRYAIUZLZSZII-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|