C22H36N2O8S2 — CID 89211760
2-[2-[2-methyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propyl]sulfanylethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 89211760) has the molecular formula C22H36N2O8S2 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-[2-[2-methyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propyl]sulfanylethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-methyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propyl]sulfanylethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89211760 |
| Molecular Formula | C22H36N2O8S2 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 2-[2-[2-methyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]propyl]sulfanylethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCSCC(C)CSCCOC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C22H36N2O8S2/c1-16(2)19(25)29-8-6-23-21(27)31-10-12-33-14-18(5)15-34-13-11-32-22(28)24-7-9-30-20(26)17(3)4/h18H,1,3,6-15H2,2,4-5H3,(H,23,27)(H,24,28) |
| InChIKey | PMZNCVHNLRTZHC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|