C22H33BrN2O10S — CID 59248520
2-[[3-[3-(2-bromoethoxy)-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 59248520) has the molecular formula C22H33BrN2O10S and a molecular weight of 597.48 g/mol. Its IUPAC name is 2-[[3-[3-(2-bromoethoxy)-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-[3-(2-bromoethoxy)-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59248520 |
| Molecular Formula | C22H33BrN2O10S |
| Molecular Weight | 597.48 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 2-[[3-[3-(2-bromoethoxy)-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(CSCCC(=O)OCCBr)OC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C22H33BrN2O10S/c1-15(2)19(27)32-10-7-24-21(29)34-13-17(14-36-12-5-18(26)31-9-6-23)35-22(30)25-8-11-33-20(28)16(3)4/h17H,1,3,5-14H2,2,4H3,(H,24,29)(H,25,30) |
| InChIKey | GXHBELJFDGTDRJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|