C23H38N2O10S — CID 170652647
2-[2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethylcarbamoyloxy]-5-sulfanylpentoxy]carbonylamino]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 170652647) has the molecular formula C23H38N2O10S and a molecular weight of 534.63 g/mol. Its IUPAC name is 2-[2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethylcarbamoyloxy]-5-sulfanylpentoxy]carbonylamino]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethylcarbamoyloxy]-5-sulfanylpentoxy]carbonylamino]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170652647 |
| Molecular Formula | C23H38N2O10S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 2-[2-[[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethylcarbamoyloxy]-5-sulfanylpentoxy]carbonylamino]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCNC(=O)OCC(CCCS)OC(=O)NCCOCCOC(=O)C(=C)C |
| InChI | InChI=1S/C23H38N2O10S/c1-17(2)20(26)32-13-11-30-9-7-24-22(28)34-16-19(6-5-15-36)35-23(29)25-8-10-31-12-14-33-21(27)18(3)4/h19,36H,1,3,5-16H2,2,4H3,(H,24,28)(H,25,29) |
| InChIKey | QWVZZAWVJRXNCH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|