C15H29NO5S — CID 139355367
2-[2-[3-(trimethyl-λ4-sulfanyl)propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 139355367) has the molecular formula C15H29NO5S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[2-[3-(trimethyl-λ4-sulfanyl)propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3-(trimethyl-λ4-sulfanyl)propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139355367 |
| Molecular Formula | C15H29NO5S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[2-[3-(trimethyl-λ4-sulfanyl)propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOCCCS(C)(C)C |
| InChI | InChI=1S/C15H29NO5S/c1-13(2)14(17)20-9-7-16-15(18)21-11-10-19-8-6-12-22(3,4)5/h1,6-12H2,2-5H3,(H,16,18) |
| InChIKey | XTAJTSYNYXIWQX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|