C26H44N2O12 — CID 153289555
2-[2-[2-(2-hydroxyethoxymethyl)-2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxymethyl]butoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 153289555) has the molecular formula C26H44N2O12 and a molecular weight of 576.64 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxymethyl)-2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxymethyl]butoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(2-hydroxyethoxymethyl)-2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxymethyl]butoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153289555 |
| Molecular Formula | C26H44N2O12 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxymethyl)-2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethoxymethyl]butoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOCC(CC)(COCCO)COCCOC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C26H44N2O12/c1-6-26(17-34-12-9-29,18-35-13-15-39-24(32)27-7-10-37-22(30)20(2)3)19-36-14-16-40-25(33)28-8-11-38-23(31)21(4)5/h29H,2,4,6-19H2,1,3,5H3,(H,27,32)(H,28,33) |
| InChIKey | DDZWESKEYTWCHB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|