C16H31NO5S — CID 155445341
2-[2-[3-[ethyl(dimethyl)-λ4-sulfanyl]propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 155445341) has the molecular formula C16H31NO5S and a molecular weight of 349.49 g/mol. Its IUPAC name is 2-[2-[3-[ethyl(dimethyl)-λ4-sulfanyl]propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3-[ethyl(dimethyl)-λ4-sulfanyl]propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155445341 |
| Molecular Formula | C16H31NO5S |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-[2-[3-[ethyl(dimethyl)-λ4-sulfanyl]propoxy]ethoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOCCCS(C)(C)CC |
| InChI | InChI=1S/C16H31NO5S/c1-6-23(4,5)13-7-9-20-11-12-22-16(19)17-8-10-21-15(18)14(2)3/h2,6-13H2,1,3-5H3,(H,17,19) |
| InChIKey | OCSAROHHEJYMFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|