C19H33NO6 — CID 123465925
2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2-tert-butyl-3,3-dimethylbutanoate (PubChem CID 123465925) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2-tert-butyl-3,3-dimethylbutanoate.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2-tert-butyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 123465925 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl 2-tert-butyl-3,3-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOC(=O)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H33NO6/c1-13(2)15(21)24-10-9-20-17(23)26-12-11-25-16(22)14(18(3,4)5)19(6,7)8/h14H,1,9-12H2,2-8H3,(H,20,23) |
| InChIKey | HZVBWCNJQZGDHK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|