C30H52N4O11 — CID 158424500
2-(propoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoyloxy)ethyl 2-methylprop-2-enoate (PubChem CID 158424500) has the molecular formula C30H52N4O11 and a molecular weight of 644.76 g/mol. Its IUPAC name is 2-(propoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoyloxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(propoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoyloxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158424500 |
| Molecular Formula | C30H52N4O11 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | 2-(propoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoylamino)ethyl 2-methylprop-2-enoate;2-(propylcarbamoyloxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCC.C=C(C)C(=O)OCCNC(=O)OCCC.C=C(C)C(=O)OCCOC(=O)NCCC |
| InChI | InChI=1S/C10H18N2O3.2C10H17NO4/c1-4-5-11-10(14)12-6-7-15-9(13)8(2)3;1-4-6-15-10(13)11-5-7-14-9(12)8(2)3;1-4-5-11-10(13)15-7-6-14-9(12)8(2)3/h2,4-7H2,1,3H3,(H2,11,12,14);2*2,4-7H2,1,3H3,(H,11,13) |
| InChIKey | HAWRFJKXSHMLLZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 196.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|