C9H17NO4 — CID 163302346
2-(ethylcarbamoyloxy)ethyl 2-methylprop-2-enoate;molecular hydrogen (PubChem CID 163302346) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(ethylcarbamoyloxy)ethyl 2-methylprop-2-enoate;molecular hydrogen.
| Compound Name | 2-(ethylcarbamoyloxy)ethyl 2-methylprop-2-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 163302346 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-(ethylcarbamoyloxy)ethyl 2-methylprop-2-enoate;molecular hydrogen |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCC.[H][H] |
| InChI | InChI=1S/C9H15NO4.H2/c1-4-10-9(12)14-6-5-13-8(11)7(2)3;/h2,4-6H2,1,3H3,(H,10,12);1H |
| InChIKey | MCQIYOKMYMKMQO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|