C10H15NO6 — CID 89172590
2-(2-formyloxyethoxycarbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 89172590) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-(2-formyloxyethoxycarbonylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-formyloxyethoxycarbonylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89172590 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(2-formyloxyethoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCOC=O |
| InChI | InChI=1S/C10H15NO6/c1-8(2)9(13)16-4-3-11-10(14)17-6-5-15-7-12/h7H,1,3-6H2,2H3,(H,11,14) |
| InChIKey | YSGJTCNILJGIOE-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|