C15H25NO7 — CID 23571684
2-[2-[2-(prop-1-en-2-yloxymethoxy)ethoxycarbonylamino]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 23571684) has the molecular formula C15H25NO7 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[2-[2-(prop-1-en-2-yloxymethoxy)ethoxycarbonylamino]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(prop-1-en-2-yloxymethoxy)ethoxycarbonylamino]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23571684 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[2-[2-(prop-1-en-2-yloxymethoxy)ethoxycarbonylamino]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)OCOCCOC(=O)NCCOCCOC(=O)C(=C)C |
| InChI | InChI=1S/C15H25NO7/c1-12(2)14(17)21-9-7-19-6-5-16-15(18)22-10-8-20-11-23-13(3)4/h1,3,5-11H2,2,4H3,(H,16,18) |
| InChIKey | PPOGRNNETWWGPM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|