C15H27NO6 — CID 58695547
2-[2-(prop-1-en-2-yloxymethoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate (PubChem CID 58695547) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-[2-(prop-1-en-2-yloxymethoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[2-(prop-1-en-2-yloxymethoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58695547 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2-[2-(prop-1-en-2-yloxymethoxy)ethylcarbamoyloxy]ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)OCOCCNC(=O)OCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C15H27NO6/c1-6-15(4,5)13(17)20-9-10-21-14(18)16-7-8-19-11-22-12(2)3/h2,6-11H2,1,3-5H3,(H,16,18) |
| InChIKey | JIXIWZSQGXVRIE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|