C12H22O4 — CID 20815860
2-(2-methylprop-2-enylperoxy)ethyl 2,2-dimethylbutanoate (PubChem CID 20815860) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylperoxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(2-methylprop-2-enylperoxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20815860 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(2-methylprop-2-enylperoxy)ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)COOCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H22O4/c1-6-12(4,5)11(13)14-7-8-15-16-9-10(2)3/h2,6-9H2,1,3-5H3 |
| InChIKey | KMPPZOMSVPGGDL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|