C13H24O5 — CID 59991240
2-(3-oxobutoxymethoxy)ethyl 2,2-dimethylbutanoate (PubChem CID 59991240) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(3-oxobutoxymethoxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(3-oxobutoxymethoxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59991240 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(3-oxobutoxymethoxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOCOCCC(C)=O |
| InChI | InChI=1S/C13H24O5/c1-5-13(3,4)12(15)18-9-8-17-10-16-7-6-11(2)14/h5-10H2,1-4H3 |
| InChIKey | VYVQMXWSGBVGQV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|