C11H15F5O4 — CID 87414406
2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2,2-dimethylbutanoate (PubChem CID 87414406) has the molecular formula C11H15F5O4 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 87414406 |
| Molecular Formula | C11H15F5O4 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F5O4/c1-4-9(2,3)7(17)19-5-6-20-8(18)10(12,13)11(14,15)16/h4-6H2,1-3H3 |
| InChIKey | QCYYCJZLBOTDOP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|