C18H26F4O6 — CID 129190167
[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] cyclohexanecarboxylate (PubChem CID 129190167) has the molecular formula C18H26F4O6 and a molecular weight of 414.39 g/mol. Its IUPAC name is [3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] cyclohexanecarboxylate.
| Compound Name | [3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 129190167 |
| Molecular Formula | C18H26F4O6 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-1,1,2,2-tetrafluoro-3-oxopropyl] cyclohexanecarboxylate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C(F)(F)C(F)(F)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H26F4O6/c1-4-16(2,3)14(24)26-10-11-27-15(25)17(19,20)18(21,22)28-13(23)12-8-6-5-7-9-12/h12H,4-11H2,1-3H3 |
| InChIKey | MUSPSJSCSTVLKE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|