C21H30F2O6 — CID 67476826
1-O-(1-adamantyl) 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2,2-difluoropropanedioate (PubChem CID 67476826) has the molecular formula C21H30F2O6 and a molecular weight of 416.46 g/mol. Its IUPAC name is 1-O-(1-adamantyl) 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2,2-difluoropropanedioate.
| Compound Name | 1-O-(1-adamantyl) 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2,2-difluoropropanedioate |
|---|---|
| PubChem CID | 67476826 |
| Molecular Formula | C21H30F2O6 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-O-(1-adamantyl) 3-O-[2-(2,2-dimethylbutanoyloxy)ethyl] 2,2-difluoropropanedioate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)C(F)(F)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30F2O6/c1-4-19(2,3)16(24)27-5-6-28-17(25)21(22,23)18(26)29-20-10-13-7-14(11-20)9-15(8-13)12-20/h13-15H,4-12H2,1-3H3 |
| InChIKey | QSKSNLNHBSZVRB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|