C14H21FO5S — CID 121382069
1-(1-adamantyloxy)-2-fluoro-1-oxobutane-2-sulfonic acid (PubChem CID 121382069) has the molecular formula C14H21FO5S and a molecular weight of 320.38 g/mol. Its IUPAC name is 1-(1-adamantyloxy)-2-fluoro-1-oxobutane-2-sulfonic acid.
| Compound Name | 1-(1-adamantyloxy)-2-fluoro-1-oxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 121382069 |
| Molecular Formula | C14H21FO5S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-(1-adamantyloxy)-2-fluoro-1-oxobutane-2-sulfonic acid |
| SMILES | CCC(F)(C(=O)OC12CC3CC(CC(C3)C1)C2)S(=O)(=O)O |
| InChI | InChI=1S/C14H21FO5S/c1-2-14(15,21(17,18)19)12(16)20-13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,2-8H2,1H3,(H,17,18,19) |
| InChIKey | ISHJGWYBTJXGNK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|