C16H22F2O8S — CID 89409804
2-[3-(1-adamantyloxy)-2-hydroxy-2-methyl-3-oxopropoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89409804) has the molecular formula C16H22F2O8S and a molecular weight of 412.41 g/mol. Its IUPAC name is 2-[3-(1-adamantyloxy)-2-hydroxy-2-methyl-3-oxopropoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[3-(1-adamantyloxy)-2-hydroxy-2-methyl-3-oxopropoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89409804 |
| Molecular Formula | C16H22F2O8S |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[3-(1-adamantyloxy)-2-hydroxy-2-methyl-3-oxopropoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CC(O)(COC(=O)C(F)(F)S(=O)(=O)O)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H22F2O8S/c1-14(21,8-25-13(20)16(17,18)27(22,23)24)12(19)26-15-5-9-2-10(6-15)4-11(3-9)7-15/h9-11,21H,2-8H2,1H3,(H,22,23,24) |
| InChIKey | KNDOAILCVHFYNO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|