C17H24F2O8S — CID 89409829
1,1-difluoro-2-[2-hydroxy-2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid (PubChem CID 89409829) has the molecular formula C17H24F2O8S and a molecular weight of 426.43 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-hydroxy-2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-hydroxy-2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89409829 |
| Molecular Formula | C17H24F2O8S |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1,1-difluoro-2-[2-hydroxy-2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid |
| SMILES | CC(O)(COC(=O)C(F)(F)S(=O)(=O)O)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H24F2O8S/c1-15(22,8-26-14(21)17(18,19)28(23,24)25)13(20)27-16(2)11-4-9-3-10(6-11)7-12(16)5-9/h9-12,22H,3-8H2,1-2H3,(H,23,24,25) |
| InChIKey | XOYKLQXLTIXLPP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|