C16H25IO2 — CID 148630811
(2-methyl-2-adamantyl) 3-iodo-2,2-dimethylpropanoate (PubChem CID 148630811) has the molecular formula C16H25IO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 3-iodo-2,2-dimethylpropanoate.
| Compound Name | (2-methyl-2-adamantyl) 3-iodo-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 148630811 |
| Molecular Formula | C16H25IO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2-methyl-2-adamantyl) 3-iodo-2,2-dimethylpropanoate |
| SMILES | CC(C)(CI)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H25IO2/c1-15(2,9-17)14(18)19-16(3)12-5-10-4-11(7-12)8-13(16)6-10/h10-13H,4-9H2,1-3H3 |
| InChIKey | NICKDZZOWWGDED-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|