C15H20F2O3 — CID 157132443
(2-methyl-2-adamantyl) 3,3-difluoro-2-oxobutanoate (PubChem CID 157132443) has the molecular formula C15H20F2O3 and a molecular weight of 286.32 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 3,3-difluoro-2-oxobutanoate.
| Compound Name | (2-methyl-2-adamantyl) 3,3-difluoro-2-oxobutanoate |
|---|---|
| PubChem CID | 157132443 |
| Molecular Formula | C15H20F2O3 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2-methyl-2-adamantyl) 3,3-difluoro-2-oxobutanoate |
| SMILES | CC(F)(F)C(=O)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C15H20F2O3/c1-14(20-13(19)12(18)15(2,16)17)10-4-8-3-9(6-10)7-11(14)5-8/h8-11H,3-7H2,1-2H3 |
| InChIKey | URKZFWNWWYBNOL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|