C19H26F2O4 — CID 89113961
4-O-(2,2-difluoropropyl) 1-O-(2-methyl-2-adamantyl) 2-methylidenebutanedioate (PubChem CID 89113961) has the molecular formula C19H26F2O4 and a molecular weight of 356.41 g/mol. Its IUPAC name is 4-O-(2,2-difluoropropyl) 1-O-(2-methyl-2-adamantyl) 2-methylidenebutanedioate.
| Compound Name | 4-O-(2,2-difluoropropyl) 1-O-(2-methyl-2-adamantyl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 89113961 |
| Molecular Formula | C19H26F2O4 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-O-(2,2-difluoropropyl) 1-O-(2-methyl-2-adamantyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC(C)(F)F)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H26F2O4/c1-11(4-16(22)24-10-18(2,20)21)17(23)25-19(3)14-6-12-5-13(8-14)9-15(19)7-12/h12-15H,1,4-10H2,2-3H3 |
| InChIKey | MAXWRDXMONTYOG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|