C17H20F2O9S — CID 89114045
4-O-(2,2-difluoropropyl) 1-O-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylidenebutanedioate (PubChem CID 89114045) has the molecular formula C17H20F2O9S and a molecular weight of 438.40 g/mol. Its IUPAC name is 4-O-(2,2-difluoropropyl) 1-O-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylidenebutanedioate.
| Compound Name | 4-O-(2,2-difluoropropyl) 1-O-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 89114045 |
| Molecular Formula | C17H20F2O9S |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 4-O-(2,2-difluoropropyl) 1-O-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCC(C)(F)F)C(=O)OCC(=O)OC1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C17H20F2O9S/c1-8(3-12(20)26-7-17(2,18)19)16(22)25-6-13(21)27-14-9-4-10-11(5-9)29(23,24)28-15(10)14/h9-11,14-15H,1,3-7H2,2H3 |
| InChIKey | HNEXTDGNBOKUCS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|