C17H29NO6S — CID 162202640
N-[2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]ethyl]-2,2-dimethylbutanamide (PubChem CID 162202640) has the molecular formula C17H29NO6S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]ethyl]-2,2-dimethylbutanamide.
| Compound Name | N-[2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]ethyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 162202640 |
| Molecular Formula | C17H29NO6S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[2-[2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]ethyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NCCOCCOC1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C17H29NO6S/c1-4-17(2,3)16(19)18-5-6-22-7-8-23-14-11-9-12-13(10-11)25(20,21)24-15(12)14/h11-15H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | WESAYWLUSSNMCK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|