C8H12O3S — CID 58520277
(2R)-2-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide (PubChem CID 58520277) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is (2R)-2-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide.
| Compound Name | (2R)-2-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
|---|---|
| PubChem CID | 58520277 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (2R)-2-methyl-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane 5,5-dioxide |
| SMILES | C[C@@H]1C2CC3C1OS(=O)(=O)C3C2 |
| InChI | InChI=1S/C8H12O3S/c1-4-5-2-6-7(3-5)12(9,10)11-8(4)6/h4-8H,2-3H2,1H3/t4-,5?,6?,7?,8?/m1/s1 |
| InChIKey | OZPSTTFPWJTFHZ-BKJPEWSUSA-N |
| XLogP | 0.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|