C10H14F2O7S2 — CID 159607376
2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoropropane-1-sulfonic acid (PubChem CID 159607376) has the molecular formula C10H14F2O7S2 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159607376 |
| Molecular Formula | C10H14F2O7S2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-[(5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC1C2CC3C1OS(=O)(=O)C3C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H14F2O7S2/c1-4(10(11,12)21(15,16)17)18-8-5-2-6-7(3-5)20(13,14)19-9(6)8/h4-9H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | MRNNZFBXRSFWGX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|