C10H12F2O8S2 — CID 89000406
1,1-difluoro-2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethanesulfonic acid (PubChem CID 89000406) has the molecular formula C10H12F2O8S2 and a molecular weight of 362.33 g/mol. Its IUPAC name is 1,1-difluoro-2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89000406 |
| Molecular Formula | C10H12F2O8S2 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1,1-difluoro-2-[(2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]-2-oxoethanesulfonic acid |
| SMILES | CC1C2CC3C1OS(=O)(=O)C3C2OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H12F2O8S2/c1-3-4-2-5-6(3)20-21(14,15)8(5)7(4)19-9(13)10(11,12)22(16,17)18/h3-8H,2H2,1H3,(H,16,17,18) |
| InChIKey | YRQKQCLZQQNMTH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|