C10H12F2O7S — CID 147186054
1,1-difluoro-2-[(7-methyl-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl)oxy]-2-oxoethanesulfonic acid (PubChem CID 147186054) has the molecular formula C10H12F2O7S and a molecular weight of 314.26 g/mol. Its IUPAC name is 1,1-difluoro-2-[(7-methyl-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl)oxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(7-methyl-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl)oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 147186054 |
| Molecular Formula | C10H12F2O7S |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1,1-difluoro-2-[(7-methyl-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl)oxy]-2-oxoethanesulfonic acid |
| SMILES | CC1CC2CC(=O)OC1C2OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H12F2O7S/c1-4-2-5-3-6(13)18-7(4)8(5)19-9(14)10(11,12)20(15,16)17/h4-5,7-8H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | CAMXPWJWTDIMPU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|