C8H10F2O6S — CID 87986554
1,1-difluoro-2-oxo-2-(4-oxocyclohexyl)oxyethanesulfonic acid (PubChem CID 87986554) has the molecular formula C8H10F2O6S and a molecular weight of 272.22 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-(4-oxocyclohexyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-(4-oxocyclohexyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 87986554 |
| Molecular Formula | C8H10F2O6S |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-(4-oxocyclohexyl)oxyethanesulfonic acid |
| SMILES | O=C1CCC(OC(=O)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C8H10F2O6S/c9-8(10,17(13,14)15)7(12)16-6-3-1-5(11)2-4-6/h6H,1-4H2,(H,13,14,15) |
| InChIKey | DDAQFBCSFJGWCE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|