C12H13NO4 — CID 66656800
(7-cyano-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl) 2-methylprop-2-enoate (PubChem CID 66656800) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (7-cyano-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl) 2-methylprop-2-enoate.
| Compound Name | (7-cyano-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66656800 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (7-cyano-3-oxo-2-oxabicyclo[3.2.1]octan-8-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C2CC(=O)OC1C(C#N)C2 |
| InChI | InChI=1S/C12H13NO4/c1-6(2)12(15)17-10-7-3-8(5-13)11(10)16-9(14)4-7/h7-8,10-11H,1,3-4H2,2H3 |
| InChIKey | INCGWLAZSQUCPT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|