C25H36O6 — CID 170853355
(1-tert-butylcyclopentyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate (PubChem CID 170853355) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1-tert-butylcyclopentyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (1-tert-butylcyclopentyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170853355 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (1-tert-butylcyclopentyl) 2-methylprop-2-enoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(C)(C)C)CCCC1.C=C(C)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C13H22O2.C12H14O4/c1-10(2)11(14)15-13(12(3,4)5)8-6-7-9-13;1-5(2)11(13)15-9-6-3-7-8(4-6)12(14)16-10(7)9/h1,6-9H2,2-5H3;6-10H,1,3-4H2,2H3 |
| InChIKey | YRHWQQPZILTDTP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|