C23H30F2O8 — CID 157479677
ethyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate (PubChem CID 157479677) has the molecular formula C23H30F2O8 and a molecular weight of 472.48 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate.
| Compound Name | ethyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157479677 |
| Molecular Formula | C23H30F2O8 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | ethyl 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C(F)(F)C(=O)OCC.C=C(C)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C12H14O4.C11H16F2O4/c1-5(2)11(13)15-9-6-3-7-8(4-6)12(14)16-10(7)9;1-5-8(17-9(14)7(3)4)11(12,13)10(15)16-6-2/h6-10H,1,3-4H2,2H3;8H,3,5-6H2,1-2,4H3 |
| InChIKey | BWADTDMGPRPGMR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|