C15H16F2O6 — CID 90328375
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-difluoropropanoyloxymethyl)prop-2-enoate (PubChem CID 90328375) has the molecular formula C15H16F2O6 and a molecular weight of 330.28 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-difluoropropanoyloxymethyl)prop-2-enoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-difluoropropanoyloxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 90328375 |
| Molecular Formula | C15H16F2O6 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(2,2-difluoropropanoyloxymethyl)prop-2-enoate |
| SMILES | C=C(COC(=O)C(C)(F)F)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C15H16F2O6/c1-6(5-21-14(20)15(2,16)17)12(18)22-10-7-3-8-9(4-7)13(19)23-11(8)10/h7-11H,1,3-5H2,2H3 |
| InChIKey | WPCRSPKGCKIWJQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|