C10H10F2O8S — CID 147640094
1,1-difluoro-2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonoperoxoic acid (PubChem CID 147640094) has the molecular formula C10H10F2O8S and a molecular weight of 328.25 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonoperoxoic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonoperoxoic acid |
|---|---|
| PubChem CID | 147640094 |
| Molecular Formula | C10H10F2O8S |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonoperoxoic acid |
| SMILES | O=C1OC2C3CC(CC13)C2OC(=O)C(F)(F)S(=O)(=O)OO |
| InChI | InChI=1S/C10H10F2O8S/c11-10(12,21(16,17)20-15)9(14)19-6-3-1-4-5(2-3)8(13)18-7(4)6/h3-7,15H,1-2H2 |
| InChIKey | GHLCCEPNXOQUSK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|