C12H15NO4 — CID 170264720
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(aziridin-1-yl)acetate (PubChem CID 170264720) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(aziridin-1-yl)acetate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(aziridin-1-yl)acetate |
|---|---|
| PubChem CID | 170264720 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-(aziridin-1-yl)acetate |
| SMILES | O=C(CN1CC1)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C12H15NO4/c14-9(5-13-1-2-13)16-10-6-3-7-8(4-6)12(15)17-11(7)10/h6-8,10-11H,1-5H2 |
| InChIKey | VGEFACBYZYTYEQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|