C15H16F3O9S- — CID 140620795
1,1,1-trifluoro-3-[4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butanoyl]oxypropane-2-sulfonate (PubChem CID 140620795) has the molecular formula C15H16F3O9S- and a molecular weight of 429.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butanoyl]oxypropane-2-sulfonate.
| Compound Name | 1,1,1-trifluoro-3-[4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butanoyl]oxypropane-2-sulfonate |
|---|---|
| PubChem CID | 140620795 |
| Molecular Formula | C15H16F3O9S- |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1,1,1-trifluoro-3-[4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butanoyl]oxypropane-2-sulfonate |
| SMILES | O=C(CCC(=O)OC1C2CC3C(=O)OC1C3C2)OCC(C(F)(F)F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H17F3O9S/c16-15(17,18)9(28(22,23)24)5-25-10(19)1-2-11(20)26-12-6-3-7-8(4-6)14(21)27-13(7)12/h6-9,12-13H,1-5H2,(H,22,23,24)/p-1 |
| InChIKey | UAXATWGUDQYTCU-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|