C20H22O11S — CID 155243464
1,4-dioxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1-[(5-oxo-4-oxatricyclo[4.3.0.03,8]nonan-2-yl)oxy]butane-2-sulfonic acid (PubChem CID 155243464) has the molecular formula C20H22O11S and a molecular weight of 470.45 g/mol. Its IUPAC name is 1,4-dioxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1-[(5-oxo-4-oxatricyclo[4.3.0.03,8]nonan-2-yl)oxy]butane-2-sulfonic acid.
| Compound Name | 1,4-dioxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1-[(5-oxo-4-oxatricyclo[4.3.0.03,8]nonan-2-yl)oxy]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 155243464 |
| Molecular Formula | C20H22O11S |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 1,4-dioxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-1-[(5-oxo-4-oxatricyclo[4.3.0.03,8]nonan-2-yl)oxy]butane-2-sulfonic acid |
| SMILES | O=C(CC(C(=O)OC1C2CC3CC2C(=O)OC31)S(=O)(=O)O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C20H22O11S/c21-13(28-14-6-1-8-11(3-6)19(23)30-16(8)14)5-12(32(25,26)27)20(24)31-17-9-2-7-4-10(9)18(22)29-15(7)17/h6-12,14-17H,1-5H2,(H,25,26,27) |
| InChIKey | MGNWEBNRAUELGN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|