C15H30BO4- — CID 158813455
boranuide;methane;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate (PubChem CID 158813455) has the molecular formula C15H30BO4- and a molecular weight of 285.21 g/mol. Its IUPAC name is boranuide;methane;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate.
| Compound Name | boranuide;methane;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 158813455 |
| Molecular Formula | C15H30BO4- |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | boranuide;methane;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate |
| SMILES | C.C.CCC(C)C(=O)OC1C2CC3C(=O)OC1C3C2.[BH4-] |
| InChI | InChI=1S/C13H18O4.2CH4.BH4/c1-3-6(2)12(14)16-10-7-4-8-9(5-7)13(15)17-11(8)10;;;/h6-11H,3-5H2,1-2H3;3*1H4/q;;;-1 |
| InChIKey | IUYXHTPKSWXOOC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|